C17H12F7N3O2S — CID 176622161
(4S)-1-[3-(difluoromethyl)-4-fluorophenyl]-3-[S-(difluoromethyl)-N-isocyanosulfonimidoyl]-5,5-difluoro-6,7-dihydro-4H-indol-4-ol (PubChem CID 176622161) has the molecular formula C17H12F7N3O2S and a molecular weight of 455.36 g/mol. Its IUPAC name is (4S)-1-[3-(difluoromethyl)-4-fluorophenyl]-3-[S-(difluoromethyl)-N-isocyanosulfonimidoyl]-5,5-difluoro-6,7-dihydro-4H-indol-4-ol.
| Compound Name | (4S)-1-[3-(difluoromethyl)-4-fluorophenyl]-3-[S-(difluoromethyl)-N-isocyanosulfonimidoyl]-5,5-difluoro-6,7-dihydro-4H-indol-4-ol |
|---|---|
| PubChem CID | 176622161 |
| Molecular Formula | C17H12F7N3O2S |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | (4S)-1-[3-(difluoromethyl)-4-fluorophenyl]-3-[S-(difluoromethyl)-N-isocyanosulfonimidoyl]-5,5-difluoro-6,7-dihydro-4H-indol-4-ol |
| SMILES | [C-]#[N+]N=S(=O)(c1cn(-c2ccc(F)c(C(F)F)c2)c2c1[C@H](O)C(F)(F)CC2)C(F)F |
| InChI | InChI=1S/C17H12F7N3O2S/c1-25-26-30(29,16(21)22)12-7-27(8-2-3-10(18)9(6-8)15(19)20)11-4-5-17(23,24)14(28)13(11)12/h2-3,6-7,14-16,28H,4-5H2/t14-,30?/m0/s1 |
| InChIKey | ULKCVLOSPNZYKC-FHEMDEPNSA-N |
| XLogP | 5.05 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|