About (9bS)-3,3-dimethyl-9b-phenyl-2-propan-2-yl-5H-benzo[e]isoindol-2-ium
(9bS)-3,3-dimethyl-9b-phenyl-2-propan-2-yl-5H-benzo[e]isoindol-2-ium (PubChem CID 176622652) has the molecular formula C23H26N+
and a molecular weight of 316.47 g/mol. Its IUPAC name is (9bS)-3,3-dimethyl-9b-phenyl-2-propan-2-yl-5H-benzo[e]isoindol-2-ium.
Molecular Properties
| Compound Name | (9bS)-3,3-dimethyl-9b-phenyl-2-propan-2-yl-5H-benzo[e]isoindol-2-ium |
| PubChem CID | 176622652 |
| Molecular Formula | C23H26N+ |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | (9bS)-3,3-dimethyl-9b-phenyl-2-propan-2-yl-5H-benzo[e]isoindol-2-ium |
| SMILES | CC(C)[N+]1=C[C@]2(c3ccccc3)C(=CCc3ccccc32)C1(C)C |
| InChI | InChI=1S/C23H26N/c1-17(2)24-16-23(19-11-6-5-7-12-19)20-13-9-8-10-18(20)14-15-21(23)22(24,3)4/h5-13,15-17H,14H2,1-4H3/q+1/t23-/m1/s1 |
| InChIKey | IZKUROOVSBGMCU-HSZRJFAPSA-N |
| XLogP | 4.74 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (9bS)-3,3-dimethyl-9b-phenyl-2-propan-2-yl-5H-benzo[e]isoindol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9bS)-3,3-dimethyl-9b-phenyl-2-propan-2-yl-5H-benzo[e]isoindol-2-ium?
The IUPAC name of (9bS)-3,3-dimethyl-9b-phenyl-2-propan-2-yl-5H-benzo[e]isoindol-2-ium (CID 176622652) is (9bS)-3,3-dimethyl-9b-phenyl-2-propan-2-yl-5H-benzo[e]isoindol-2-ium.
What is the SMILES notation for (9bS)-3,3-dimethyl-9b-phenyl-2-propan-2-yl-5H-benzo[e]isoindol-2-ium?
The canonical SMILES for (9bS)-3,3-dimethyl-9b-phenyl-2-propan-2-yl-5H-benzo[e]isoindol-2-ium is CC(C)[N+]1=C[C@]2(c3ccccc3)C(=CCc3ccccc32)C1(C)C.
What is the InChIKey of (9bS)-3,3-dimethyl-9b-phenyl-2-propan-2-yl-5H-benzo[e]isoindol-2-ium?
The InChIKey is IZKUROOVSBGMCU-HSZRJFAPSA-N. The full InChI is InChI=1S/C23H26N/c1-17(2)24-16-23(19-11-6-5-7-12-19)20-13-9-8-10-18(20)14-15-21(23)22(24,3)4/h5-13,15-17H,14H2,1-4H3/q+1/t23-/m1/s1.
What are the key properties of (9bS)-3,3-dimethyl-9b-phenyl-2-propan-2-yl-5H-benzo[e]isoindol-2-ium?
(9bS)-3,3-dimethyl-9b-phenyl-2-propan-2-yl-5H-benzo[e]isoindol-2-ium has a molecular weight of 316.47 g/mol, XLogP of 4.74, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (9bS)-3,3-dimethyl-9b-phenyl-2-propan-2-yl-5H-benzo[e]isoindol-2-ium is sourced from PubChem (CID 176622652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).