C41H44N4 — CID 176623205
9-[2-[4,6-bis(1-adamantyl)-1,3,5-triazin-2-yl]phenyl]-4a,9a-dihydrocarbazole (PubChem CID 176623205) has the molecular formula C41H44N4 and a molecular weight of 592.83 g/mol. Its IUPAC name is 9-[2-[4,6-bis(1-adamantyl)-1,3,5-triazin-2-yl]phenyl]-4a,9a-dihydrocarbazole.
| Compound Name | 9-[2-[4,6-bis(1-adamantyl)-1,3,5-triazin-2-yl]phenyl]-4a,9a-dihydrocarbazole |
|---|---|
| PubChem CID | 176623205 |
| Molecular Formula | C41H44N4 |
| Molecular Weight | 592.83 g/mol |
| Exact Mass | 592.36 |
| IUPAC Name | 9-[2-[4,6-bis(1-adamantyl)-1,3,5-triazin-2-yl]phenyl]-4a,9a-dihydrocarbazole |
| SMILES | C1=CC2c3ccccc3N(c3ccccc3-c3nc(C45CC6CC(CC(C6)C4)C5)nc(C45CC6CC(CC(C6)C4)C5)n3)C2C=C1 |
| InChI | InChI=1S/C41H44N4/c1-4-10-34-31(7-1)32-8-2-5-11-35(32)45(34)36-12-6-3-9-33(36)37-42-38(40-19-25-13-26(20-40)15-27(14-25)21-40)44-39(43-37)41-22-28-16-29(23-41)18-30(17-28)24-41/h1-12,25-31,34H,13-24H2 |
| InChIKey | DUWHWRWLLUUWPC-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.83 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |