C15H24F2O — CID 176623536
(5S,6aR)-1',1'-difluoro-6a-[(2-methylpropan-2-yl)oxymethyl]spiro[1,2,3,3a,4,6-hexahydropentalene-5,2'-cyclopropane] (PubChem CID 176623536) has the molecular formula C15H24F2O and a molecular weight of 258.35 g/mol. Its IUPAC name is (5S,6aR)-1',1'-difluoro-6a-[(2-methylpropan-2-yl)oxymethyl]spiro[1,2,3,3a,4,6-hexahydropentalene-5,2'-cyclopropane].
| Compound Name | (5S,6aR)-1',1'-difluoro-6a-[(2-methylpropan-2-yl)oxymethyl]spiro[1,2,3,3a,4,6-hexahydropentalene-5,2'-cyclopropane] |
|---|---|
| PubChem CID | 176623536 |
| Molecular Formula | C15H24F2O |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (5S,6aR)-1',1'-difluoro-6a-[(2-methylpropan-2-yl)oxymethyl]spiro[1,2,3,3a,4,6-hexahydropentalene-5,2'-cyclopropane] |
| SMILES | CC(C)(C)OC[C@@]12CCCC1C[C@@]1(CC1(F)F)C2 |
| InChI | InChI=1S/C15H24F2O/c1-12(2,3)18-10-13-6-4-5-11(13)7-14(8-13)9-15(14,16)17/h11H,4-10H2,1-3H3/t11?,13-,14-/m0/s1 |
| InChIKey | CMMXCLORXUYOKV-VNXPTHQBSA-N |
| XLogP | 4.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |