C19H18ClF3N4 — CID 176625065
(1S)-1-[4-(4-chloro-2,7,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-10-yl)phenyl]-2,2,2-trifluoro-N-methylethanamine (PubChem CID 176625065) has the molecular formula C19H18ClF3N4 and a molecular weight of 394.83 g/mol. Its IUPAC name is (1S)-1-[4-(4-chloro-2,7,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-10-yl)phenyl]-2,2,2-trifluoro-N-methylethanamine.
| Compound Name | (1S)-1-[4-(4-chloro-2,7,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-10-yl)phenyl]-2,2,2-trifluoro-N-methylethanamine |
|---|---|
| PubChem CID | 176625065 |
| Molecular Formula | C19H18ClF3N4 |
| Molecular Weight | 394.83 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (1S)-1-[4-(4-chloro-2,7,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-10-yl)phenyl]-2,2,2-trifluoro-N-methylethanamine |
| SMILES | CN[C@@H](c1ccc(N2CCCc3c2cnc2cc(Cl)cn32)cc1)C(F)(F)F |
| InChI | InChI=1S/C19H18ClF3N4/c1-24-18(19(21,22)23)12-4-6-14(7-5-12)26-8-2-3-15-16(26)10-25-17-9-13(20)11-27(15)17/h4-7,9-11,18,24H,2-3,8H2,1H3/t18-/m0/s1 |
| InChIKey | FWMVHLKFZONJKU-SFHVURJKSA-N |
| XLogP | 4.89 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.83 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |