About 2-propan-2-yl-5-(4-propan-2-ylphenyl)sulfinylbenzene-1,3-dicarbonitrile
2-propan-2-yl-5-(4-propan-2-ylphenyl)sulfinylbenzene-1,3-dicarbonitrile (PubChem CID 176626070) has the molecular formula C20H20N2OS
and a molecular weight of 336.46 g/mol. Its IUPAC name is 2-propan-2-yl-5-(4-propan-2-ylphenyl)sulfinylbenzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 2-propan-2-yl-5-(4-propan-2-ylphenyl)sulfinylbenzene-1,3-dicarbonitrile |
| PubChem CID | 176626070 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-propan-2-yl-5-(4-propan-2-ylphenyl)sulfinylbenzene-1,3-dicarbonitrile |
| SMILES | CC(C)c1ccc(S(=O)c2cc(C#N)c(C(C)C)c(C#N)c2)cc1 |
| InChI | InChI=1S/C20H20N2OS/c1-13(2)15-5-7-18(8-6-15)24(23)19-9-16(11-21)20(14(3)4)17(10-19)12-22/h5-10,13-14H,1-4H3 |
| InChIKey | SUKSGMRGPXDBGA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propan-2-yl-5-(4-propan-2-ylphenyl)sulfinylbenzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-5-(4-propan-2-ylphenyl)sulfinylbenzene-1,3-dicarbonitrile?
The IUPAC name of 2-propan-2-yl-5-(4-propan-2-ylphenyl)sulfinylbenzene-1,3-dicarbonitrile (CID 176626070) is 2-propan-2-yl-5-(4-propan-2-ylphenyl)sulfinylbenzene-1,3-dicarbonitrile.
What is the SMILES notation for 2-propan-2-yl-5-(4-propan-2-ylphenyl)sulfinylbenzene-1,3-dicarbonitrile?
The canonical SMILES for 2-propan-2-yl-5-(4-propan-2-ylphenyl)sulfinylbenzene-1,3-dicarbonitrile is CC(C)c1ccc(S(=O)c2cc(C#N)c(C(C)C)c(C#N)c2)cc1.
What is the InChIKey of 2-propan-2-yl-5-(4-propan-2-ylphenyl)sulfinylbenzene-1,3-dicarbonitrile?
The InChIKey is SUKSGMRGPXDBGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2OS/c1-13(2)15-5-7-18(8-6-15)24(23)19-9-16(11-21)20(14(3)4)17(10-19)12-22/h5-10,13-14H,1-4H3.
What are the key properties of 2-propan-2-yl-5-(4-propan-2-ylphenyl)sulfinylbenzene-1,3-dicarbonitrile?
2-propan-2-yl-5-(4-propan-2-ylphenyl)sulfinylbenzene-1,3-dicarbonitrile has a molecular weight of 336.46 g/mol, XLogP of 4.84, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-5-(4-propan-2-ylphenyl)sulfinylbenzene-1,3-dicarbonitrile is sourced from PubChem (CID 176626070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).