C25H26N2O4 — CID 176629648
[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,7a-tetrahydro-2H-indol-6-yl] 4-isocyanobenzoate (PubChem CID 176629648) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is [3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,7a-tetrahydro-2H-indol-6-yl] 4-isocyanobenzoate.
| Compound Name | [3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,7a-tetrahydro-2H-indol-6-yl] 4-isocyanobenzoate |
|---|---|
| PubChem CID | 176629648 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | [3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,7a-tetrahydro-2H-indol-6-yl] 4-isocyanobenzoate |
| SMILES | [C-]#[N+]c1ccc(C(=O)OC2=CC3N(C)CCC3(c3ccc(OC)c(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C25H26N2O4/c1-26-19-8-5-17(6-9-19)24(28)31-20-11-12-25(13-14-27(2)23(25)16-20)18-7-10-21(29-3)22(15-18)30-4/h5-10,15-16,23H,11-14H2,2-4H3 |
| InChIKey | WSXXPEQJCWLASA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 52.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|