About [(E)-3-fluoro-4,4-dimethylpent-2-en-2-yl]cyclopropane
[(E)-3-fluoro-4,4-dimethylpent-2-en-2-yl]cyclopropane (PubChem CID 176632008) has the molecular formula C10H17F
and a molecular weight of 156.24 g/mol. Its IUPAC name is [(E)-3-fluoro-4,4-dimethylpent-2-en-2-yl]cyclopropane.
Analyze [(E)-3-fluoro-4,4-dimethylpent-2-en-2-yl]cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3-fluoro-4,4-dimethylpent-2-en-2-yl]cyclopropane?
The IUPAC name of [(E)-3-fluoro-4,4-dimethylpent-2-en-2-yl]cyclopropane (CID 176632008) is [(E)-3-fluoro-4,4-dimethylpent-2-en-2-yl]cyclopropane.
What is the SMILES notation for [(E)-3-fluoro-4,4-dimethylpent-2-en-2-yl]cyclopropane?
The canonical SMILES for [(E)-3-fluoro-4,4-dimethylpent-2-en-2-yl]cyclopropane is C/C(=C(\F)C(C)(C)C)C1CC1.
What is the InChIKey of [(E)-3-fluoro-4,4-dimethylpent-2-en-2-yl]cyclopropane?
The InChIKey is AGKDYORPUIEOMS-VQHVLOKHSA-N. The full InChI is InChI=1S/C10H17F/c1-7(8-5-6-8)9(11)10(2,3)4/h8H,5-6H2,1-4H3/b9-7+.
What are the key properties of [(E)-3-fluoro-4,4-dimethylpent-2-en-2-yl]cyclopropane?
[(E)-3-fluoro-4,4-dimethylpent-2-en-2-yl]cyclopropane has a molecular weight of 156.24 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-fluoro-4,4-dimethylpent-2-en-2-yl]cyclopropane is sourced from PubChem (CID 176632008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).