C43H27N3 — CID 176632257
4-[6-(4-isocyanophenyl)naphthalen-2-yl]-2-phenyl-6-(8-phenylnaphthalen-1-yl)pyrimidine (PubChem CID 176632257) has the molecular formula C43H27N3 and a molecular weight of 585.71 g/mol. Its IUPAC name is 4-[6-(4-isocyanophenyl)naphthalen-2-yl]-2-phenyl-6-(8-phenylnaphthalen-1-yl)pyrimidine.
| Compound Name | 4-[6-(4-isocyanophenyl)naphthalen-2-yl]-2-phenyl-6-(8-phenylnaphthalen-1-yl)pyrimidine |
|---|---|
| PubChem CID | 176632257 |
| Molecular Formula | C43H27N3 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | 4-[6-(4-isocyanophenyl)naphthalen-2-yl]-2-phenyl-6-(8-phenylnaphthalen-1-yl)pyrimidine |
| SMILES | [C-]#[N+]c1ccc(-c2ccc3cc(-c4cc(-c5cccc6cccc(-c7ccccc7)c56)nc(-c5ccccc5)n4)ccc3c2)cc1 |
| InChI | InChI=1S/C43H27N3/c1-44-37-24-22-29(23-25-37)33-18-19-35-27-36(21-20-34(35)26-33)40-28-41(46-43(45-40)32-12-6-3-7-13-32)39-17-9-15-31-14-8-16-38(42(31)39)30-10-4-2-5-11-30/h2-28H |
| InChIKey | IUHLKYQDAPJLEY-UHFFFAOYSA-N |
| XLogP | 11.67 |
| TPSA | 30.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|