C17H22F3N3O4 — CID 176632875
tert-butyl 4-(6-methoxycarbonyl-3-pyridinyl)-3-(trifluoromethyl)piperazine-1-carboxylate (PubChem CID 176632875) has the molecular formula C17H22F3N3O4 and a molecular weight of 389.37 g/mol. Its IUPAC name is tert-butyl 4-(6-methoxycarbonyl-3-pyridinyl)-3-(trifluoromethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-methoxycarbonyl-3-pyridinyl)-3-(trifluoromethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176632875 |
| Molecular Formula | C17H22F3N3O4 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | tert-butyl 4-(6-methoxycarbonyl-3-pyridinyl)-3-(trifluoromethyl)piperazine-1-carboxylate |
| SMILES | COC(=O)c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2C(F)(F)F)cn1 |
| InChI | InChI=1S/C17H22F3N3O4/c1-16(2,3)27-15(25)22-7-8-23(13(10-22)17(18,19)20)11-5-6-12(21-9-11)14(24)26-4/h5-6,9,13H,7-8,10H2,1-4H3 |
| InChIKey | YGYKGSLQEJQBFG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |