C17H21FN2O2 — CID 176635660
3-[(2S)-1-(4-fluorophenyl)-3-oxopropan-2-yl]-2,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 176635660) has the molecular formula C17H21FN2O2 and a molecular weight of 304.36 g/mol. Its IUPAC name is 3-[(2S)-1-(4-fluorophenyl)-3-oxopropan-2-yl]-2,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | 3-[(2S)-1-(4-fluorophenyl)-3-oxopropan-2-yl]-2,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 176635660 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 3-[(2S)-1-(4-fluorophenyl)-3-oxopropan-2-yl]-2,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | NC(=O)C1([C@@H](C=O)Cc2ccc(F)cc2)NCC2CCCC21 |
| InChI | InChI=1S/C17H21FN2O2/c18-14-6-4-11(5-7-14)8-13(10-21)17(16(19)22)15-3-1-2-12(15)9-20-17/h4-7,10,12-13,15,20H,1-3,8-9H2,(H2,19,22)/t12?,13-,15?,17?/m1/s1 |
| InChIKey | MYZDEQQEODCFQO-URMCTSMKSA-N |
| XLogP | 1.43 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|