C50H56F4O5S — CID 176636684
2,3,5,6-tetrafluoro-4-[4-(2,5'-spirobi[bicyclo[2.2.1]heptane]-2'-yl)-2,6-bis(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)benzoyl]oxybenzenesulfonic acid (PubChem CID 176636684) has the molecular formula C50H56F4O5S and a molecular weight of 845.05 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[4-(2,5'-spirobi[bicyclo[2.2.1]heptane]-2'-yl)-2,6-bis(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)benzoyl]oxybenzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[4-(2,5'-spirobi[bicyclo[2.2.1]heptane]-2'-yl)-2,6-bis(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)benzoyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 176636684 |
| Molecular Formula | C50H56F4O5S |
| Molecular Weight | 845.05 g/mol |
| Exact Mass | 844.38 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[4-(2,5'-spirobi[bicyclo[2.2.1]heptane]-2'-yl)-2,6-bis(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)benzoyl]oxybenzenesulfonic acid |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)O)c(F)c1F)c1c(C2CC3CC2C2C4CCC(C4)C32)cc(C2CC3CC2CC32CC3CCC2C3)cc1C1CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C50H56F4O5S/c51-43-45(53)48(60(56,57)58)46(54)44(52)47(43)59-49(55)42-36(32-13-26-15-34(32)40-23-4-2-21(8-23)38(26)40)11-25(31-17-30-10-28(31)19-50(30)18-20-1-6-29(50)7-20)12-37(42)33-14-27-16-35(33)41-24-5-3-22(9-24)39(27)41/h11-12,20-24,26-35,38-41H,1-10,13-19H2,(H,56,57,58) |
| InChIKey | FRKSAGLKQWKJEZ-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.05 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|