C24H25FN10OS2 — CID 176637119
2-amino-1'-[4-[bis(cyanomethyl)amino]-6-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-1,3,5-triazin-2-yl]spiro[6H-thieno[2,3-c]thiophene-4,3'-azetidine]-3-carbonitrile (PubChem CID 176637119) has the molecular formula C24H25FN10OS2 and a molecular weight of 552.67 g/mol. Its IUPAC name is 2-amino-1'-[4-[bis(cyanomethyl)amino]-6-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-1,3,5-triazin-2-yl]spiro[6H-thieno[2,3-c]thiophene-4,3'-azetidine]-3-carbonitrile.
| Compound Name | 2-amino-1'-[4-[bis(cyanomethyl)amino]-6-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-1,3,5-triazin-2-yl]spiro[6H-thieno[2,3-c]thiophene-4,3'-azetidine]-3-carbonitrile |
|---|---|
| PubChem CID | 176637119 |
| Molecular Formula | C24H25FN10OS2 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | 2-amino-1'-[4-[bis(cyanomethyl)amino]-6-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-1,3,5-triazin-2-yl]spiro[6H-thieno[2,3-c]thiophene-4,3'-azetidine]-3-carbonitrile |
| SMILES | N#CCN(CC#N)c1nc(OC[C@@]23CCCN2C[C@H](F)C3)nc(N2CC3(C2)SCc2sc(N)c(C#N)c23)n1 |
| InChI | InChI=1S/C24H25FN10OS2/c25-15-8-23(2-1-5-35(23)10-15)14-36-22-31-20(33(6-3-26)7-4-27)30-21(32-22)34-12-24(13-34)18-16(9-28)19(29)38-17(18)11-37-24/h15H,1-2,5-8,10-14,29H2/t15-,23+/m1/s1 |
| InChIKey | RKZCIIFLZBENLJ-CMJOXMDJSA-N |
| XLogP | 2.16 |
| TPSA | 155.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|