C39H22N4OS — CID 176637265
1,2,3,4,6,7,8,9,10,11-decadeuterio-5-[4-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)-6-phenyl-1,3,5-triazin-2-yl]-[1]benzofuro[3,2-c]carbazole (PubChem CID 176637265) has the molecular formula C39H22N4OS and a molecular weight of 611.80 g/mol. Its IUPAC name is 1,2,3,4,6,7,8,9,10,11-decadeuterio-5-[4-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)-6-phenyl-1,3,5-triazin-2-yl]-[1]benzofuro[3,2-c]carbazole.
| Compound Name | 1,2,3,4,6,7,8,9,10,11-decadeuterio-5-[4-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)-6-phenyl-1,3,5-triazin-2-yl]-[1]benzofuro[3,2-c]carbazole |
|---|---|
| PubChem CID | 176637265 |
| Molecular Formula | C39H22N4OS |
| Molecular Weight | 611.80 g/mol |
| Exact Mass | 611.26 |
| IUPAC Name | 1,2,3,4,6,7,8,9,10,11-decadeuterio-5-[4-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)-6-phenyl-1,3,5-triazin-2-yl]-[1]benzofuro[3,2-c]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c2c([2H])c([2H])c2c3c3c([2H])c([2H])c([2H])c([2H])c3n2-c2nc(-c3ccccc3)nc(-c3c([2H])c([2H])c([2H])c4c3sc3c([2H])c([2H])c([2H])c([2H])c34)n2)c1[2H] |
| InChI | InChI=1S/C39H22N4OS/c1-2-11-23(12-3-1)37-40-38(29-17-10-16-27-25-14-6-9-20-33(25)45-36(27)29)42-39(41-37)43-30-18-7-4-15-28(30)34-31(43)22-21-26-24-13-5-8-19-32(24)44-35(26)34/h1-22H/i4D,5D,6D,7D,8D,9D,10D,13D,14D,15D,16D,17D,18D,19D,20D,21D,22D |
| InChIKey | YMEYKZNACGDKFV-PSLHQTLTSA-N |
| XLogP | 10.57 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.80 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |