C22H21ClFN7OS — CID 176638952
4-[4-amino-6-chloro-8-fluoro-2-(4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)quinazolin-7-yl]-1,3-benzothiazol-2-amine (PubChem CID 176638952) has the molecular formula C22H21ClFN7OS and a molecular weight of 485.98 g/mol. Its IUPAC name is 4-[4-amino-6-chloro-8-fluoro-2-(4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)quinazolin-7-yl]-1,3-benzothiazol-2-amine.
| Compound Name | 4-[4-amino-6-chloro-8-fluoro-2-(4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)quinazolin-7-yl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 176638952 |
| Molecular Formula | C22H21ClFN7OS |
| Molecular Weight | 485.98 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 4-[4-amino-6-chloro-8-fluoro-2-(4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)quinazolin-7-yl]-1,3-benzothiazol-2-amine |
| SMILES | CN1CCOC2CN(c3nc(N)c4cc(Cl)c(-c5cccc6sc(N)nc56)c(F)c4n3)CC21 |
| InChI | InChI=1S/C22H21ClFN7OS/c1-30-5-6-32-14-9-31(8-13(14)30)22-28-19-11(20(25)29-22)7-12(23)16(17(19)24)10-3-2-4-15-18(10)27-21(26)33-15/h2-4,7,13-14H,5-6,8-9H2,1H3,(H2,26,27)(H2,25,28,29) |
| InChIKey | RXMLHVQHASJWRX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.98 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |