About methyl 3-[[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-2-pyridinyl]oxy]cyclobutane-1-carboxylate
methyl 3-[[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-2-pyridinyl]oxy]cyclobutane-1-carboxylate (PubChem CID 176639293) has the molecular formula C17H23N3O3
and a molecular weight of 317.39 g/mol. Its IUPAC name is methyl 3-[[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-2-pyridinyl]oxy]cyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-2-pyridinyl]oxy]cyclobutane-1-carboxylate |
| PubChem CID | 176639293 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | methyl 3-[[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-2-pyridinyl]oxy]cyclobutane-1-carboxylate |
| SMILES | COC(=O)C1CC(Oc2cc(N3C4CCC3CNC4)ccn2)C1 |
| InChI | InChI=1S/C17H23N3O3/c1-22-17(21)11-6-15(7-11)23-16-8-12(4-5-19-16)20-13-2-3-14(20)10-18-9-13/h4-5,8,11,13-15,18H,2-3,6-7,9-10H2,1H3 |
| InChIKey | BTBCIEMSPYQOFS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-2-pyridinyl]oxy]cyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-2-pyridinyl]oxy]cyclobutane-1-carboxylate?
The IUPAC name of methyl 3-[[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-2-pyridinyl]oxy]cyclobutane-1-carboxylate (CID 176639293) is methyl 3-[[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-2-pyridinyl]oxy]cyclobutane-1-carboxylate.
What is the SMILES notation for methyl 3-[[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-2-pyridinyl]oxy]cyclobutane-1-carboxylate?
The canonical SMILES for methyl 3-[[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-2-pyridinyl]oxy]cyclobutane-1-carboxylate is COC(=O)C1CC(Oc2cc(N3C4CCC3CNC4)ccn2)C1.
What is the InChIKey of methyl 3-[[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-2-pyridinyl]oxy]cyclobutane-1-carboxylate?
The InChIKey is BTBCIEMSPYQOFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O3/c1-22-17(21)11-6-15(7-11)23-16-8-12(4-5-19-16)20-13-2-3-14(20)10-18-9-13/h4-5,8,11,13-15,18H,2-3,6-7,9-10H2,1H3.
What are the key properties of methyl 3-[[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-2-pyridinyl]oxy]cyclobutane-1-carboxylate?
methyl 3-[[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-2-pyridinyl]oxy]cyclobutane-1-carboxylate has a molecular weight of 317.39 g/mol, XLogP of 1.35, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-2-pyridinyl]oxy]cyclobutane-1-carboxylate is sourced from PubChem (CID 176639293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).