About 5-tert-butylpyrido[1,2-c]pyrimidin-1-imine
5-tert-butylpyrido[1,2-c]pyrimidin-1-imine (PubChem CID 176640659) has the molecular formula C12H15N3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 5-tert-butylpyrido[1,2-c]pyrimidin-1-imine.
Molecular Properties
| Compound Name | 5-tert-butylpyrido[1,2-c]pyrimidin-1-imine |
| PubChem CID | 176640659 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 5-tert-butylpyrido[1,2-c]pyrimidin-1-imine |
| SMILES | [H]/N=c1\nccc2c(C(C)(C)C)cccn12 |
| InChI | InChI=1S/C12H15N3/c1-12(2,3)9-5-4-8-15-10(9)6-7-14-11(15)13/h4-8,13H,1-3H3/b13-11+ |
| InChIKey | VKKNQEZRYGXGGL-ACCUITESSA-N |
| XLogP | 2.11 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-tert-butylpyrido[1,2-c]pyrimidin-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butylpyrido[1,2-c]pyrimidin-1-imine?
The IUPAC name of 5-tert-butylpyrido[1,2-c]pyrimidin-1-imine (CID 176640659) is 5-tert-butylpyrido[1,2-c]pyrimidin-1-imine.
What is the SMILES notation for 5-tert-butylpyrido[1,2-c]pyrimidin-1-imine?
The canonical SMILES for 5-tert-butylpyrido[1,2-c]pyrimidin-1-imine is [H]/N=c1\nccc2c(C(C)(C)C)cccn12.
What is the InChIKey of 5-tert-butylpyrido[1,2-c]pyrimidin-1-imine?
The InChIKey is VKKNQEZRYGXGGL-ACCUITESSA-N. The full InChI is InChI=1S/C12H15N3/c1-12(2,3)9-5-4-8-15-10(9)6-7-14-11(15)13/h4-8,13H,1-3H3/b13-11+.
What are the key properties of 5-tert-butylpyrido[1,2-c]pyrimidin-1-imine?
5-tert-butylpyrido[1,2-c]pyrimidin-1-imine has a molecular weight of 201.27 g/mol, XLogP of 2.11, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butylpyrido[1,2-c]pyrimidin-1-imine is sourced from PubChem (CID 176640659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).