C53H37F2N5Pt — CID 176642486
9-(4-tert-butyl-2-pyridinyl)-2-(2-carbazol-9-id-1-yl-1-phenylbenzimidazol-4-yl)-6-[difluoro(phenyl)methyl]-1H-carbazol-1-ide;platinum(2+) (PubChem CID 176642486) has the molecular formula C53H37F2N5Pt and a molecular weight of 976.99 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-(2-carbazol-9-id-1-yl-1-phenylbenzimidazol-4-yl)-6-[difluoro(phenyl)methyl]-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-(2-carbazol-9-id-1-yl-1-phenylbenzimidazol-4-yl)-6-[difluoro(phenyl)methyl]-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 176642486 |
| Molecular Formula | C53H37F2N5Pt |
| Molecular Weight | 976.99 g/mol |
| Exact Mass | 976.27 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-(2-carbazol-9-id-1-yl-1-phenylbenzimidazol-4-yl)-6-[difluoro(phenyl)methyl]-1H-carbazol-1-ide;platinum(2+) |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(-c4cccc5c4nc(-c4cccc6c4[n-]c4ccccc46)n5-c4ccccc4)ccc3c3cc(C(F)(F)c4ccccc4)ccc32)c1.[Pt+2] |
| InChI | InChI=1S/C53H37F2N5.Pt/c1-52(2,3)35-28-29-56-48(32-35)60-45-27-25-36(53(54,55)34-14-6-4-7-15-34)31-43(45)40-26-24-33(30-47(40)60)38-19-13-23-46-50(38)58-51(59(46)37-16-8-5-9-17-37)42-21-12-20-41-39-18-10-11-22-44(39)57-49(41)42;/h4-29,31-32H,1-3H3;/q-2;+2 |
| InChIKey | VBZIANBVLTVIRC-UHFFFAOYSA-N |
| XLogP | 13.35 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 976.99 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|