C57H40N6Pt — CID 176643442
9-[3-[7-tert-butyl-1-phenyl-2-(3-pyridin-4-ylcarbazol-9-id-1-yl)benzimidazol-4-yl]-5-phenylbenzene-2-id-1-yl]pyrido[2,3-b]indole;platinum(2+) (PubChem CID 176643442) has the molecular formula C57H40N6Pt and a molecular weight of 1004.07 g/mol. Its IUPAC name is 9-[3-[7-tert-butyl-1-phenyl-2-(3-pyridin-4-ylcarbazol-9-id-1-yl)benzimidazol-4-yl]-5-phenylbenzene-2-id-1-yl]pyrido[2,3-b]indole;platinum(2+).
| Compound Name | 9-[3-[7-tert-butyl-1-phenyl-2-(3-pyridin-4-ylcarbazol-9-id-1-yl)benzimidazol-4-yl]-5-phenylbenzene-2-id-1-yl]pyrido[2,3-b]indole;platinum(2+) |
|---|---|
| PubChem CID | 176643442 |
| Molecular Formula | C57H40N6Pt |
| Molecular Weight | 1004.07 g/mol |
| Exact Mass | 1003.30 |
| IUPAC Name | 9-[3-[7-tert-butyl-1-phenyl-2-(3-pyridin-4-ylcarbazol-9-id-1-yl)benzimidazol-4-yl]-5-phenylbenzene-2-id-1-yl]pyrido[2,3-b]indole;platinum(2+) |
| SMILES | CC(C)(C)c1ccc(-c2[c-]c(-n3c4ccccc4c4cccnc43)cc(-c3ccccc3)c2)c2nc(-c3cc(-c4ccncc4)cc4c3[n-]c3ccccc34)n(-c3ccccc3)c12.[Pt+2] |
| InChI | InChI=1S/C57H40N6.Pt/c1-57(2,3)49-25-24-43(40-31-38(36-15-6-4-7-16-36)32-42(33-40)62-51-23-13-11-20-45(51)46-21-14-28-59-55(46)62)53-54(49)63(41-17-8-5-9-18-41)56(61-53)48-35-39(37-26-29-58-30-27-37)34-47-44-19-10-12-22-50(44)60-52(47)48;/h4-32,34-35H,1-3H3;/q-2;+2 |
| InChIKey | UOZJOLLRDPFMDD-UHFFFAOYSA-N |
| XLogP | 13.94 |
| TPSA | 62.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1004.07 |
| LogP ≤ 5 | 13.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|