C33H22FN3OS — CID 176644075
8-[1-(2,4-dimethyldibenzofuran-3-yl)benzimidazol-2-yl]-2-fluoro-5-methyl-[1]benzothiolo[2,3-b]pyridine (PubChem CID 176644075) has the molecular formula C33H22FN3OS and a molecular weight of 527.62 g/mol. Its IUPAC name is 8-[1-(2,4-dimethyldibenzofuran-3-yl)benzimidazol-2-yl]-2-fluoro-5-methyl-[1]benzothiolo[2,3-b]pyridine.
| Compound Name | 8-[1-(2,4-dimethyldibenzofuran-3-yl)benzimidazol-2-yl]-2-fluoro-5-methyl-[1]benzothiolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 176644075 |
| Molecular Formula | C33H22FN3OS |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 8-[1-(2,4-dimethyldibenzofuran-3-yl)benzimidazol-2-yl]-2-fluoro-5-methyl-[1]benzothiolo[2,3-b]pyridine |
| SMILES | Cc1cc2c(oc3ccccc32)c(C)c1-n1c(-c2ccc(C)c3c2sc2nc(F)ccc23)nc2ccccc21 |
| InChI | InChI=1S/C33H22FN3OS/c1-17-12-13-22(31-28(17)21-14-15-27(34)36-33(21)39-31)32-35-24-9-5-6-10-25(24)37(32)29-18(2)16-23-20-8-4-7-11-26(20)38-30(23)19(29)3/h4-16H,1-3H3 |
| InChIKey | MEKQCNPXMBNQIN-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|