C35H32FNO6 — CID 176644498
2-[(2S,3R,4R,5S,6R)-2-fluoro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione (PubChem CID 176644498) has the molecular formula C35H32FNO6 and a molecular weight of 581.64 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5S,6R)-2-fluoro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,3R,4R,5S,6R)-2-fluoro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 176644498 |
| Molecular Formula | C35H32FNO6 |
| Molecular Weight | 581.64 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | 2-[(2S,3R,4R,5S,6R)-2-fluoro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@H]1F |
| InChI | InChI=1S/C35H32FNO6/c36-33-30(37-34(38)27-18-10-11-19-28(27)35(37)39)32(42-22-26-16-8-3-9-17-26)31(41-21-25-14-6-2-7-15-25)29(43-33)23-40-20-24-12-4-1-5-13-24/h1-19,29-33H,20-23H2/t29-,30-,31-,32-,33-/m1/s1 |
| InChIKey | QHDINSZMSLJATD-YKNMHBIISA-N |
| XLogP | 5.73 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.64 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|