C17H19F6N5O — CID 176644516
(1S)-3-[4,6-bis[(3,3-difluorocyclobutyl)amino]-1,3,5-triazin-2-yl]-2,6-difluorocyclohex-2-en-1-ol (PubChem CID 176644516) has the molecular formula C17H19F6N5O and a molecular weight of 423.36 g/mol. Its IUPAC name is (1S)-3-[4,6-bis[(3,3-difluorocyclobutyl)amino]-1,3,5-triazin-2-yl]-2,6-difluorocyclohex-2-en-1-ol.
| Compound Name | (1S)-3-[4,6-bis[(3,3-difluorocyclobutyl)amino]-1,3,5-triazin-2-yl]-2,6-difluorocyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 176644516 |
| Molecular Formula | C17H19F6N5O |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | (1S)-3-[4,6-bis[(3,3-difluorocyclobutyl)amino]-1,3,5-triazin-2-yl]-2,6-difluorocyclohex-2-en-1-ol |
| SMILES | O[C@@H]1C(F)=C(c2nc(NC3CC(F)(F)C3)nc(NC3CC(F)(F)C3)n2)CCC1F |
| InChI | InChI=1S/C17H19F6N5O/c18-10-2-1-9(11(19)12(10)29)13-26-14(24-7-3-16(20,21)4-7)28-15(27-13)25-8-5-17(22,23)6-8/h7-8,10,12,29H,1-6H2,(H2,24,25,26,27,28)/t10?,12-/m0/s1 |
| InChIKey | QDRUWRRQELSBTH-KFJBMODSSA-N |
| XLogP | 3.46 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |