C44H35N3Si — CID 176645495
trimethyl-[4-[4-naphthalen-2-yl-6-[3-(3-naphthalen-1-ylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]silane (PubChem CID 176645495) has the molecular formula C44H35N3Si and a molecular weight of 633.87 g/mol. Its IUPAC name is trimethyl-[4-[4-naphthalen-2-yl-6-[3-(3-naphthalen-1-ylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]silane.
| Compound Name | trimethyl-[4-[4-naphthalen-2-yl-6-[3-(3-naphthalen-1-ylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]silane |
|---|---|
| PubChem CID | 176645495 |
| Molecular Formula | C44H35N3Si |
| Molecular Weight | 633.87 g/mol |
| Exact Mass | 633.26 |
| IUPAC Name | trimethyl-[4-[4-naphthalen-2-yl-6-[3-(3-naphthalen-1-ylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]silane |
| SMILES | C[Si](C)(C)c1ccc(-c2nc(-c3cccc(-c4cccc(-c5cccc6ccccc56)c4)c3)nc(-c3ccc4ccccc4c3)n2)cc1 |
| InChI | InChI=1S/C44H35N3Si/c1-48(2,3)39-25-23-32(24-26-39)42-45-43(47-44(46-42)38-22-21-30-11-4-5-13-33(30)28-38)37-18-9-16-35(29-37)34-15-8-17-36(27-34)41-20-10-14-31-12-6-7-19-40(31)41/h4-29H,1-3H3 |
| InChIKey | OIHGBOTYZCKHPE-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.87 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|