C12H18N2 — CID 176645790
(2R)-2-methyl-1-propan-2-yl-3-(trideuteriomethyl)-2H-benzimidazole (PubChem CID 176645790) has the molecular formula C12H18N2 and a molecular weight of 193.31 g/mol. Its IUPAC name is (2R)-2-methyl-1-propan-2-yl-3-(trideuteriomethyl)-2H-benzimidazole.
| Compound Name | (2R)-2-methyl-1-propan-2-yl-3-(trideuteriomethyl)-2H-benzimidazole |
|---|---|
| PubChem CID | 176645790 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.17 |
| IUPAC Name | (2R)-2-methyl-1-propan-2-yl-3-(trideuteriomethyl)-2H-benzimidazole |
| SMILES | [2H]C([2H])([2H])N1c2ccccc2N(C(C)C)[C@@H]1C |
| InChI | InChI=1S/C12H18N2/c1-9(2)14-10(3)13(4)11-7-5-6-8-12(11)14/h5-10H,1-4H3/t10-/m1/s1/i4D3 |
| InChIKey | QKHGADZVOKBRPB-MPKIDMPZSA-N |
| XLogP | 2.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |