About 3,4-ditert-butyl-1,3-dihydropyrazin-2-one
3,4-ditert-butyl-1,3-dihydropyrazin-2-one (PubChem CID 176646508) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is 3,4-ditert-butyl-1,3-dihydropyrazin-2-one.
Molecular Properties
| Compound Name | 3,4-ditert-butyl-1,3-dihydropyrazin-2-one |
| PubChem CID | 176646508 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 3,4-ditert-butyl-1,3-dihydropyrazin-2-one |
| SMILES | CC(C)(C)C1C(=O)NC=CN1C(C)(C)C |
| InChI | InChI=1S/C12H22N2O/c1-11(2,3)9-10(15)13-7-8-14(9)12(4,5)6/h7-9H,1-6H3,(H,13,15) |
| InChIKey | HINLBTQOPYQIQQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-ditert-butyl-1,3-dihydropyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-ditert-butyl-1,3-dihydropyrazin-2-one?
The IUPAC name of 3,4-ditert-butyl-1,3-dihydropyrazin-2-one (CID 176646508) is 3,4-ditert-butyl-1,3-dihydropyrazin-2-one.
What is the SMILES notation for 3,4-ditert-butyl-1,3-dihydropyrazin-2-one?
The canonical SMILES for 3,4-ditert-butyl-1,3-dihydropyrazin-2-one is CC(C)(C)C1C(=O)NC=CN1C(C)(C)C.
What is the InChIKey of 3,4-ditert-butyl-1,3-dihydropyrazin-2-one?
The InChIKey is HINLBTQOPYQIQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O/c1-11(2,3)9-10(15)13-7-8-14(9)12(4,5)6/h7-9H,1-6H3,(H,13,15).
What are the key properties of 3,4-ditert-butyl-1,3-dihydropyrazin-2-one?
3,4-ditert-butyl-1,3-dihydropyrazin-2-one has a molecular weight of 210.32 g/mol, XLogP of 2.10, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-ditert-butyl-1,3-dihydropyrazin-2-one is sourced from PubChem (CID 176646508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).