C48H30O — CID 176646920
2-[1,2,3,4,5,6,7,8-octadeuterio-10-[4-(3-phenylphenyl)naphthalen-1-yl]anthracen-9-yl]dibenzofuran (PubChem CID 176646920) has the molecular formula C48H30O and a molecular weight of 630.82 g/mol. Its IUPAC name is 2-[1,2,3,4,5,6,7,8-octadeuterio-10-[4-(3-phenylphenyl)naphthalen-1-yl]anthracen-9-yl]dibenzofuran.
| Compound Name | 2-[1,2,3,4,5,6,7,8-octadeuterio-10-[4-(3-phenylphenyl)naphthalen-1-yl]anthracen-9-yl]dibenzofuran |
|---|---|
| PubChem CID | 176646920 |
| Molecular Formula | C48H30O |
| Molecular Weight | 630.82 g/mol |
| Exact Mass | 630.28 |
| IUPAC Name | 2-[1,2,3,4,5,6,7,8-octadeuterio-10-[4-(3-phenylphenyl)naphthalen-1-yl]anthracen-9-yl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc(-c4cccc(-c5ccccc5)c4)c4ccccc34)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccc4oc5ccccc5c4c3)c2c1[2H] |
| InChI | InChI=1S/C48H30O/c1-2-13-31(14-3-1)32-15-12-16-33(29-32)35-26-27-43(37-18-5-4-17-36(35)37)48-41-22-8-6-20-39(41)47(40-21-7-9-23-42(40)48)34-25-28-46-44(30-34)38-19-10-11-24-45(38)49-46/h1-30H/i6D,7D,8D,9D,20D,21D,22D,23D |
| InChIKey | BQTJJIPLPUGWCT-UGEOKFNRSA-N |
| XLogP | 13.71 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.82 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|