C38H17F5N4OS — CID 176647188
8-[4-(2,3,4,5,6-pentafluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]-5-phenyl-4-oxa-14-thia-6-azapentacyclo[11.7.0.02,10.03,7.015,20]icosa-1(13),2,5,7,9,11,15,17,19-nonaene (PubChem CID 176647188) has the molecular formula C38H17F5N4OS and a molecular weight of 672.64 g/mol. Its IUPAC name is 8-[4-(2,3,4,5,6-pentafluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]-5-phenyl-4-oxa-14-thia-6-azapentacyclo[11.7.0.02,10.03,7.015,20]icosa-1(13),2,5,7,9,11,15,17,19-nonaene.
| Compound Name | 8-[4-(2,3,4,5,6-pentafluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]-5-phenyl-4-oxa-14-thia-6-azapentacyclo[11.7.0.02,10.03,7.015,20]icosa-1(13),2,5,7,9,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 176647188 |
| Molecular Formula | C38H17F5N4OS |
| Molecular Weight | 672.64 g/mol |
| Exact Mass | 672.10 |
| IUPAC Name | 8-[4-(2,3,4,5,6-pentafluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]-5-phenyl-4-oxa-14-thia-6-azapentacyclo[11.7.0.02,10.03,7.015,20]icosa-1(13),2,5,7,9,11,15,17,19-nonaene |
| SMILES | Fc1c(F)c(F)c(-c2nc(-c3ccccc3)nc(-c3cc4ccc5sc6ccccc6c5c4c4oc(-c5ccccc5)nc34)n2)c(F)c1F |
| InChI | InChI=1S/C38H17F5N4OS/c39-28-27(29(40)31(42)32(43)30(28)41)37-46-35(18-9-3-1-4-10-18)45-36(47-37)22-17-20-15-16-24-26(21-13-7-8-14-23(21)49-24)25(20)34-33(22)44-38(48-34)19-11-5-2-6-12-19/h1-17H |
| InChIKey | HEBNSYHEFAWQLQ-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.64 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|