C31H23N3O2 — CID 176647215
2-tert-butyl-4-dibenzofuran-3-yl-6-dibenzofuran-4-yl-1,3,5-triazine (PubChem CID 176647215) has the molecular formula C31H23N3O2 and a molecular weight of 469.54 g/mol. Its IUPAC name is 2-tert-butyl-4-dibenzofuran-3-yl-6-dibenzofuran-4-yl-1,3,5-triazine.
| Compound Name | 2-tert-butyl-4-dibenzofuran-3-yl-6-dibenzofuran-4-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 176647215 |
| Molecular Formula | C31H23N3O2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 2-tert-butyl-4-dibenzofuran-3-yl-6-dibenzofuran-4-yl-1,3,5-triazine |
| SMILES | CC(C)(C)c1nc(-c2ccc3c(c2)oc2ccccc23)nc(-c2cccc3c2oc2ccccc23)n1 |
| InChI | InChI=1S/C31H23N3O2/c1-31(2,3)30-33-28(18-15-16-21-19-9-4-6-13-24(19)35-26(21)17-18)32-29(34-30)23-12-8-11-22-20-10-5-7-14-25(20)36-27(22)23/h4-17H,1-3H3 |
| InChIKey | NNCAIMVVBSJJCP-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |