C17H15NO5S — CID 176647358
[(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]-3-oxo-1-benzofuran-6-yl] hydrogen sulfite (PubChem CID 176647358) has the molecular formula C17H15NO5S and a molecular weight of 345.38 g/mol. Its IUPAC name is [(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]-3-oxo-1-benzofuran-6-yl] hydrogen sulfite.
| Compound Name | [(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]-3-oxo-1-benzofuran-6-yl] hydrogen sulfite |
|---|---|
| PubChem CID | 176647358 |
| Molecular Formula | C17H15NO5S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | [(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]-3-oxo-1-benzofuran-6-yl] hydrogen sulfite |
| SMILES | CN(C)c1ccc(/C=C2\Oc3cc(OS(=O)O)ccc3C2=O)cc1 |
| InChI | InChI=1S/C17H15NO5S/c1-18(2)12-5-3-11(4-6-12)9-16-17(19)14-8-7-13(23-24(20)21)10-15(14)22-16/h3-10H,1-2H3,(H,20,21)/b16-9- |
| InChIKey | RFTGZSDNJWPWFJ-SXGWCWSVSA-N |
| XLogP | 2.88 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|