C28H31N7O3 — CID 176647815
1-cyclobutyl-3-[4-[3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]phenyl]pyrrolidine-2,5-dione (PubChem CID 176647815) has the molecular formula C28H31N7O3 and a molecular weight of 513.60 g/mol. Its IUPAC name is 1-cyclobutyl-3-[4-[3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]phenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-cyclobutyl-3-[4-[3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 176647815 |
| Molecular Formula | C28H31N7O3 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | 1-cyclobutyl-3-[4-[3-methanimidoyl-6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrazol-5-ylamino)-4-pyridinyl]phenyl]pyrrolidine-2,5-dione |
| SMILES | [H]/N=C/c1c(-c2ccc(C3CC(=O)N(C4CCC4)C3=O)cc2)cc(N2CCOC[C@H]2C)nc1Nc1ccn[nH]1 |
| InChI | InChI=1S/C28H31N7O3/c1-17-16-38-12-11-34(17)25-13-21(23(15-29)27(32-25)31-24-9-10-30-33-24)18-5-7-19(8-6-18)22-14-26(36)35(28(22)37)20-3-2-4-20/h5-10,13,15,17,20,22,29H,2-4,11-12,14,16H2,1H3,(H2,30,31,32,33)/b29-15+/t17-,22?/m1/s1 |
| InChIKey | LUUCMUPCUNYZSV-WFNCVKRISA-N |
| XLogP | 3.83 |
| TPSA | 127.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|