C13H6O9S3 — CID 176647865
2,2,2',2'-tetraoxospiro[1,3,2-dioxathietane-4,4'-6H-thiochromeno[2,3-e][1,3,2]benzodioxathiole]-5'-one (PubChem CID 176647865) has the molecular formula C13H6O9S3 and a molecular weight of 402.38 g/mol. Its IUPAC name is 2,2,2',2'-tetraoxospiro[1,3,2-dioxathietane-4,4'-6H-thiochromeno[2,3-e][1,3,2]benzodioxathiole]-5'-one.
| Compound Name | 2,2,2',2'-tetraoxospiro[1,3,2-dioxathietane-4,4'-6H-thiochromeno[2,3-e][1,3,2]benzodioxathiole]-5'-one |
|---|---|
| PubChem CID | 176647865 |
| Molecular Formula | C13H6O9S3 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 401.92 |
| IUPAC Name | 2,2,2',2'-tetraoxospiro[1,3,2-dioxathietane-4,4'-6H-thiochromeno[2,3-e][1,3,2]benzodioxathiole]-5'-one |
| SMILES | O=C1C2=C(Sc3ccccc3C2)C2=C(OS(=O)(=O)O2)C12OS(=O)(=O)O2 |
| InChI | InChI=1S/C13H6O9S3/c14-11-7-5-6-3-1-2-4-8(6)23-10(7)9-12(20-24(15,16)19-9)13(11)21-25(17,18)22-13/h1-4H,5H2 |
| InChIKey | CHDOHVUXNZIFNR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |