C26H30F2N4O4 — CID 176647983
(3R)-3-[[2-[[2-(4,4-difluorocyclohexyl)acetyl]amino]acetyl]amino]-2-oxo-4-phenyl-N-(pyridin-2-ylmethyl)butanamide (PubChem CID 176647983) has the molecular formula C26H30F2N4O4 and a molecular weight of 500.55 g/mol. Its IUPAC name is (3R)-3-[[2-[[2-(4,4-difluorocyclohexyl)acetyl]amino]acetyl]amino]-2-oxo-4-phenyl-N-(pyridin-2-ylmethyl)butanamide.
| Compound Name | (3R)-3-[[2-[[2-(4,4-difluorocyclohexyl)acetyl]amino]acetyl]amino]-2-oxo-4-phenyl-N-(pyridin-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 176647983 |
| Molecular Formula | C26H30F2N4O4 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | (3R)-3-[[2-[[2-(4,4-difluorocyclohexyl)acetyl]amino]acetyl]amino]-2-oxo-4-phenyl-N-(pyridin-2-ylmethyl)butanamide |
| SMILES | O=C(CC1CCC(F)(F)CC1)NCC(=O)N[C@H](Cc1ccccc1)C(=O)C(=O)NCc1ccccn1 |
| InChI | InChI=1S/C26H30F2N4O4/c27-26(28)11-9-19(10-12-26)15-22(33)30-17-23(34)32-21(14-18-6-2-1-3-7-18)24(35)25(36)31-16-20-8-4-5-13-29-20/h1-8,13,19,21H,9-12,14-17H2,(H,30,33)(H,31,36)(H,32,34)/t21-/m1/s1 |
| InChIKey | UQCAREHIEYNIJH-OAQYLSRUSA-N |
| XLogP | 2.33 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|