C23H28N6O3S — CID 176648074
(2S,4R)-1-[(2S)-2-azido-3-methylbutanoyl]-4-hydroxy-N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]cyclopropyl]pyrrolidine-2-carboxamide (PubChem CID 176648074) has the molecular formula C23H28N6O3S and a molecular weight of 468.58 g/mol. Its IUPAC name is (2S,4R)-1-[(2S)-2-azido-3-methylbutanoyl]-4-hydroxy-N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]cyclopropyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(2S)-2-azido-3-methylbutanoyl]-4-hydroxy-N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]cyclopropyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 176648074 |
| Molecular Formula | C23H28N6O3S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | (2S,4R)-1-[(2S)-2-azido-3-methylbutanoyl]-4-hydroxy-N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]cyclopropyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ncsc1-c1ccc(C2(NC(=O)[C@@H]3C[C@@H](O)CN3C(=O)[C@@H](N=[N+]=[N-])C(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H28N6O3S/c1-13(2)19(27-28-24)22(32)29-11-17(30)10-18(29)21(31)26-23(8-9-23)16-6-4-15(5-7-16)20-14(3)25-12-33-20/h4-7,12-13,17-19,30H,8-11H2,1-3H3,(H,26,31)/t17-,18+,19+/m1/s1 |
| InChIKey | HKNHTAXVDBVHER-QYZOEREBSA-N |
| XLogP | 3.52 |
| TPSA | 131.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|