C10H14F2N2O — CID 176649785
1,1-difluoro-2-(2-propan-2-ylpyrimidin-5-yl)propan-2-ol (PubChem CID 176649785) has the molecular formula C10H14F2N2O and a molecular weight of 216.23 g/mol. Its IUPAC name is 1,1-difluoro-2-(2-propan-2-ylpyrimidin-5-yl)propan-2-ol.
| Compound Name | 1,1-difluoro-2-(2-propan-2-ylpyrimidin-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 176649785 |
| Molecular Formula | C10H14F2N2O |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 1,1-difluoro-2-(2-propan-2-ylpyrimidin-5-yl)propan-2-ol |
| SMILES | CC(C)c1ncc(C(C)(O)C(F)F)cn1 |
| InChI | InChI=1S/C10H14F2N2O/c1-6(2)8-13-4-7(5-14-8)10(3,15)9(11)12/h4-6,9,15H,1-3H3 |
| InChIKey | GJLHKZVWRVRHFS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |