C10H11F3N6O3 — CID 176650262
methyl N-methyl-4-oxo-3-[2-(trifluoromethoxy)ethyl]imidazo[5,1-d][1,2,3,5]tetrazine-8-carboximidate (PubChem CID 176650262) has the molecular formula C10H11F3N6O3 and a molecular weight of 320.23 g/mol. Its IUPAC name is methyl N-methyl-4-oxo-3-[2-(trifluoromethoxy)ethyl]imidazo[5,1-d][1,2,3,5]tetrazine-8-carboximidate.
| Compound Name | methyl N-methyl-4-oxo-3-[2-(trifluoromethoxy)ethyl]imidazo[5,1-d][1,2,3,5]tetrazine-8-carboximidate |
|---|---|
| PubChem CID | 176650262 |
| Molecular Formula | C10H11F3N6O3 |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | methyl N-methyl-4-oxo-3-[2-(trifluoromethoxy)ethyl]imidazo[5,1-d][1,2,3,5]tetrazine-8-carboximidate |
| SMILES | C/N=C(\OC)c1ncn2c(=O)n(CCOC(F)(F)F)nnc12 |
| InChI | InChI=1S/C10H11F3N6O3/c1-14-8(21-2)6-7-16-17-19(3-4-22-10(11,12)13)9(20)18(7)5-15-6/h5H,3-4H2,1-2H3/b14-8- |
| InChIKey | ZEXHCKTYCFEARF-ZSOIEALJSA-N |
| XLogP | -0.15 |
| TPSA | 95.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|