C11H14F3N7O2 — CID 176650266
N,N,N'-trimethyl-4-oxo-3-[2-(trifluoromethoxy)ethyl]imidazo[5,1-d][1,2,3,5]tetrazine-8-carboximidamide (PubChem CID 176650266) has the molecular formula C11H14F3N7O2 and a molecular weight of 333.27 g/mol. Its IUPAC name is N,N,N'-trimethyl-4-oxo-3-[2-(trifluoromethoxy)ethyl]imidazo[5,1-d][1,2,3,5]tetrazine-8-carboximidamide.
| Compound Name | N,N,N'-trimethyl-4-oxo-3-[2-(trifluoromethoxy)ethyl]imidazo[5,1-d][1,2,3,5]tetrazine-8-carboximidamide |
|---|---|
| PubChem CID | 176650266 |
| Molecular Formula | C11H14F3N7O2 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | N,N,N'-trimethyl-4-oxo-3-[2-(trifluoromethoxy)ethyl]imidazo[5,1-d][1,2,3,5]tetrazine-8-carboximidamide |
| SMILES | C/N=C(/c1ncn2c(=O)n(CCOC(F)(F)F)nnc12)N(C)C |
| InChI | InChI=1S/C11H14F3N7O2/c1-15-8(19(2)3)7-9-17-18-21(4-5-23-11(12,13)14)10(22)20(9)6-16-7/h6H,4-5H2,1-3H3/b15-8- |
| InChIKey | DALZBSPWNFTPME-NVNXTCNLSA-N |
| XLogP | -0.24 |
| TPSA | 89.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|