C21H36N10O9 — CID 176652074
tert-butyl N-[N'-[[1-[(2R,4R,5S)-2-(azidomethoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]triazol-4-yl]methylamino]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 176652074) has the molecular formula C21H36N10O9 and a molecular weight of 572.58 g/mol. Its IUPAC name is tert-butyl N-[N'-[[1-[(2R,4R,5S)-2-(azidomethoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]triazol-4-yl]methylamino]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[[1-[(2R,4R,5S)-2-(azidomethoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]triazol-4-yl]methylamino]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 176652074 |
| Molecular Formula | C21H36N10O9 |
| Molecular Weight | 572.58 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | tert-butyl N-[N'-[[1-[(2R,4R,5S)-2-(azidomethoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]triazol-4-yl]methylamino]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NNCc1cn(C2[C@@H](OCN=[N+]=[N-])OC(CO)[C@@H](O)[C@@H]2O)nn1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H36N10O9/c1-20(2,3)39-18(35)25-17(26-19(36)40-21(4,5)6)28-23-7-11-8-31(30-27-11)13-15(34)14(33)12(9-32)38-16(13)37-10-24-29-22/h8,12-16,23,32-34H,7,9-10H2,1-6H3,(H2,25,26,28,35,36)/t12?,13?,14-,15-,16+/m1/s1 |
| InChIKey | PCKAXEGECFGKBT-PEHJNBARSA-N |
| XLogP | -0.05 |
| TPSA | 259.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.58 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|