C21H35N9O9 — CID 176652100
tert-butyl N-[N'-[[1-[(2R,4R,5S)-2-(azidomethoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]triazol-4-yl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 176652100) has the molecular formula C21H35N9O9 and a molecular weight of 557.57 g/mol. Its IUPAC name is tert-butyl N-[N'-[[1-[(2R,4R,5S)-2-(azidomethoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]triazol-4-yl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[[1-[(2R,4R,5S)-2-(azidomethoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]triazol-4-yl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 176652100 |
| Molecular Formula | C21H35N9O9 |
| Molecular Weight | 557.57 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | tert-butyl N-[N'-[[1-[(2R,4R,5S)-2-(azidomethoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]triazol-4-yl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NCc1cn(C2[C@@H](OCN=[N+]=[N-])OC(CO)[C@@H](O)[C@@H]2O)nn1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H35N9O9/c1-20(2,3)38-18(34)25-17(26-19(35)39-21(4,5)6)23-7-11-8-30(29-27-11)13-15(33)14(32)12(9-31)37-16(13)36-10-24-28-22/h8,12-16,31-33H,7,9-10H2,1-6H3,(H2,23,25,26,34,35)/t12?,13?,14-,15-,16+/m1/s1 |
| InChIKey | SYLGOQXMZIIBEO-PEHJNBARSA-N |
| XLogP | 0.45 |
| TPSA | 247.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.57 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|