C9H9N2O6P — CID 176653374
phosphonooxymethyl 3H-benzimidazole-5-carboxylate (PubChem CID 176653374) has the molecular formula C9H9N2O6P and a molecular weight of 272.15 g/mol. Its IUPAC name is phosphonooxymethyl 3H-benzimidazole-5-carboxylate.
| Compound Name | phosphonooxymethyl 3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 176653374 |
| Molecular Formula | C9H9N2O6P |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | phosphonooxymethyl 3H-benzimidazole-5-carboxylate |
| SMILES | O=C(OCOP(=O)(O)O)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C9H9N2O6P/c12-9(16-5-17-18(13,14)15)6-1-2-7-8(3-6)11-4-10-7/h1-4H,5H2,(H,10,11)(H2,13,14,15) |
| InChIKey | RTOAMDSHPKENOR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 121.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|