C22H21ClFN3O2 — CID 176653548
tert-butyl N-[[4-(4-chloro-2-pyridinyl)-6-(4-fluorophenyl)-3-pyridinyl]methyl]carbamate (PubChem CID 176653548) has the molecular formula C22H21ClFN3O2 and a molecular weight of 413.88 g/mol. Its IUPAC name is tert-butyl N-[[4-(4-chloro-2-pyridinyl)-6-(4-fluorophenyl)-3-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-(4-chloro-2-pyridinyl)-6-(4-fluorophenyl)-3-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 176653548 |
| Molecular Formula | C22H21ClFN3O2 |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | tert-butyl N-[[4-(4-chloro-2-pyridinyl)-6-(4-fluorophenyl)-3-pyridinyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cnc(-c2ccc(F)cc2)cc1-c1cc(Cl)ccn1 |
| InChI | InChI=1S/C22H21ClFN3O2/c1-22(2,3)29-21(28)27-13-15-12-26-19(14-4-6-17(24)7-5-14)11-18(15)20-10-16(23)8-9-25-20/h4-12H,13H2,1-3H3,(H,27,28) |
| InChIKey | AKLBIXUGBLMLTO-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |