C27H38N3O6Si — CID 176654663
CID 176654663 (PubChem CID 176654663) has the molecular formula C27H38N3O6Si and a molecular weight of 528.70 g/mol.
| Compound Name | CID 176654663 |
|---|---|
| PubChem CID | 176654663 |
| Molecular Formula | C27H38N3O6Si |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO[Si](c1ccccc1)c1ccc(C(C)(C)C)cc1)C(=O)N[C@@H](CO)C(N)=O |
| InChI | InChI=1S/C27H38N3O6Si/c1-26(2,3)18-12-14-20(15-13-18)37(19-10-8-7-9-11-19)35-17-22(30-25(34)36-27(4,5)6)24(33)29-21(16-31)23(28)32/h7-15,21-22,31H,16-17H2,1-6H3,(H2,28,32)(H,29,33)(H,30,34)/t21-,22-/m0/s1 |
| InChIKey | OBRARBFGBLULPR-VXKWHMMOSA-N |
| XLogP | 0.96 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|