C16H21N3O2 — CID 176655602
(10R,15S)-12-(3-hydroxypropyl)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one (PubChem CID 176655602) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is (10R,15S)-12-(3-hydroxypropyl)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one.
| Compound Name | (10R,15S)-12-(3-hydroxypropyl)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
|---|---|
| PubChem CID | 176655602 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (10R,15S)-12-(3-hydroxypropyl)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
| SMILES | O=C1CN2c3c(cccc3[C@@H]3CN(CCCO)CC[C@@H]32)N1 |
| InChI | InChI=1S/C16H21N3O2/c20-8-2-6-18-7-5-14-12(9-18)11-3-1-4-13-16(11)19(14)10-15(21)17-13/h1,3-4,12,14,20H,2,5-10H2,(H,17,21)/t12-,14-/m0/s1 |
| InChIKey | VIKYJZBWIUROIZ-JSGCOSHPSA-N |
| XLogP | 1.00 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |