C36H41N7O6S — CID 176655745
5-[[4-[(2R)-2-[(6-cyclopropylfuro[2,3-b]pyrazin-2-yl)methylamino]-4,4-dimethylpentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoylimino]cyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 176655745) has the molecular formula C36H41N7O6S and a molecular weight of 699.83 g/mol. Its IUPAC name is 5-[[4-[(2R)-2-[(6-cyclopropylfuro[2,3-b]pyrazin-2-yl)methylamino]-4,4-dimethylpentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoylimino]cyclohexa-1,3-diene-1-carboxylic acid.
| Compound Name | 5-[[4-[(2R)-2-[(6-cyclopropylfuro[2,3-b]pyrazin-2-yl)methylamino]-4,4-dimethylpentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoylimino]cyclohexa-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 176655745 |
| Molecular Formula | C36H41N7O6S |
| Molecular Weight | 699.83 g/mol |
| Exact Mass | 699.28 |
| IUPAC Name | 5-[[4-[(2R)-2-[(6-cyclopropylfuro[2,3-b]pyrazin-2-yl)methylamino]-4,4-dimethylpentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoylimino]cyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | Cc1cccc(C)c1-c1cc(OC[C@@H](CC(C)(C)C)NCc2cnc3oc(C4CC4)cc3n2)nc(NS(=O)(=O)N=C2C=CC=C(C(=O)O)C2)n1 |
| InChI | InChI=1S/C36H41N7O6S/c1-21-8-6-9-22(2)32(21)28-16-31(41-35(40-28)43-50(46,47)42-25-11-7-10-24(14-25)34(44)45)48-20-26(17-36(3,4)5)37-18-27-19-38-33-29(39-27)15-30(49-33)23-12-13-23/h6-11,15-16,19,23,26,37H,12-14,17-18,20H2,1-5H3,(H,44,45)(H,40,41,43)/t26-/m1/s1 |
| InChIKey | PZNOKEMYXUFRRF-AREMUKBSSA-N |
| XLogP | 6.22 |
| TPSA | 181.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.83 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|