C20H24ClNO3 — CID 176655923
tert-butyl 3-[3-(3-chloropropoxy)-2-methylphenyl]pyridine-2-carboxylate (PubChem CID 176655923) has the molecular formula C20H24ClNO3 and a molecular weight of 361.87 g/mol. Its IUPAC name is tert-butyl 3-[3-(3-chloropropoxy)-2-methylphenyl]pyridine-2-carboxylate.
| Compound Name | tert-butyl 3-[3-(3-chloropropoxy)-2-methylphenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 176655923 |
| Molecular Formula | C20H24ClNO3 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | tert-butyl 3-[3-(3-chloropropoxy)-2-methylphenyl]pyridine-2-carboxylate |
| SMILES | Cc1c(OCCCCl)cccc1-c1cccnc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H24ClNO3/c1-14-15(8-5-10-17(14)24-13-7-11-21)16-9-6-12-22-18(16)19(23)25-20(2,3)4/h5-6,8-10,12H,7,11,13H2,1-4H3 |
| InChIKey | SAHLFRSZPIZYFL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|