C54H64N6O7S — CID 176656358
tert-butyl 2-[1-[7-[[4-[2-(dimethylamino)ethyl]phenyl]methyl]-2-(ethoxymethyl)-4-(tritylamino)imidazo[4,5-c]quinolin-1-yl]-2-methylpropan-2-yl]oxyethylsulfamoyl carbonate (PubChem CID 176656358) has the molecular formula C54H64N6O7S and a molecular weight of 941.21 g/mol. Its IUPAC name is tert-butyl 2-[1-[7-[[4-[2-(dimethylamino)ethyl]phenyl]methyl]-2-(ethoxymethyl)-4-(tritylamino)imidazo[4,5-c]quinolin-1-yl]-2-methylpropan-2-yl]oxyethylsulfamoyl carbonate.
| Compound Name | tert-butyl 2-[1-[7-[[4-[2-(dimethylamino)ethyl]phenyl]methyl]-2-(ethoxymethyl)-4-(tritylamino)imidazo[4,5-c]quinolin-1-yl]-2-methylpropan-2-yl]oxyethylsulfamoyl carbonate |
|---|---|
| PubChem CID | 176656358 |
| Molecular Formula | C54H64N6O7S |
| Molecular Weight | 941.21 g/mol |
| Exact Mass | 940.46 |
| IUPAC Name | tert-butyl 2-[1-[7-[[4-[2-(dimethylamino)ethyl]phenyl]methyl]-2-(ethoxymethyl)-4-(tritylamino)imidazo[4,5-c]quinolin-1-yl]-2-methylpropan-2-yl]oxyethylsulfamoyl carbonate |
| SMILES | CCOCc1nc2c(NC(c3ccccc3)(c3ccccc3)c3ccccc3)nc3cc(Cc4ccc(CCN(C)C)cc4)ccc3c2n1CC(C)(C)OCCNS(=O)(=O)OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C54H64N6O7S/c1-9-64-37-47-57-48-49(60(47)38-53(5,6)65-34-32-55-68(62,63)67-51(61)66-52(2,3)4)45-30-29-41(35-40-27-25-39(26-28-40)31-33-59(7)8)36-46(45)56-50(48)58-54(42-19-13-10-14-20-42,43-21-15-11-16-22-43)44-23-17-12-18-24-44/h10-30,36,55H,9,31-35,37-38H2,1-8H3,(H,56,58) |
| InChIKey | LRVVSCCBYROJNQ-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 146.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.21 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|