About methyl 2-(2,2-dimethylpropanoylamino)-2-[2-fluoro-4-[(1-methylcyclopentyl)methoxy]phenyl]acetate
methyl 2-(2,2-dimethylpropanoylamino)-2-[2-fluoro-4-[(1-methylcyclopentyl)methoxy]phenyl]acetate (PubChem CID 176657255) has the molecular formula C21H30FNO4
and a molecular weight of 379.47 g/mol. Its IUPAC name is methyl 2-(2,2-dimethylpropanoylamino)-2-[2-fluoro-4-[(1-methylcyclopentyl)methoxy]phenyl]acetate.
Molecular Properties
| Compound Name | methyl 2-(2,2-dimethylpropanoylamino)-2-[2-fluoro-4-[(1-methylcyclopentyl)methoxy]phenyl]acetate |
| PubChem CID | 176657255 |
| Molecular Formula | C21H30FNO4 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | methyl 2-(2,2-dimethylpropanoylamino)-2-[2-fluoro-4-[(1-methylcyclopentyl)methoxy]phenyl]acetate |
| SMILES | COC(=O)C(NC(=O)C(C)(C)C)c1ccc(OCC2(C)CCCC2)cc1F |
| InChI | InChI=1S/C21H30FNO4/c1-20(2,3)19(25)23-17(18(24)26-5)15-9-8-14(12-16(15)22)27-13-21(4)10-6-7-11-21/h8-9,12,17H,6-7,10-11,13H2,1-5H3,(H,23,25) |
| InChIKey | GACCRLQQXZFMQB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(2,2-dimethylpropanoylamino)-2-[2-fluoro-4-[(1-methylcyclopentyl)methoxy]phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2,2-dimethylpropanoylamino)-2-[2-fluoro-4-[(1-methylcyclopentyl)methoxy]phenyl]acetate?
The IUPAC name of methyl 2-(2,2-dimethylpropanoylamino)-2-[2-fluoro-4-[(1-methylcyclopentyl)methoxy]phenyl]acetate (CID 176657255) is methyl 2-(2,2-dimethylpropanoylamino)-2-[2-fluoro-4-[(1-methylcyclopentyl)methoxy]phenyl]acetate.
What is the SMILES notation for methyl 2-(2,2-dimethylpropanoylamino)-2-[2-fluoro-4-[(1-methylcyclopentyl)methoxy]phenyl]acetate?
The canonical SMILES for methyl 2-(2,2-dimethylpropanoylamino)-2-[2-fluoro-4-[(1-methylcyclopentyl)methoxy]phenyl]acetate is COC(=O)C(NC(=O)C(C)(C)C)c1ccc(OCC2(C)CCCC2)cc1F.
What is the InChIKey of methyl 2-(2,2-dimethylpropanoylamino)-2-[2-fluoro-4-[(1-methylcyclopentyl)methoxy]phenyl]acetate?
The InChIKey is GACCRLQQXZFMQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30FNO4/c1-20(2,3)19(25)23-17(18(24)26-5)15-9-8-14(12-16(15)22)27-13-21(4)10-6-7-11-21/h8-9,12,17H,6-7,10-11,13H2,1-5H3,(H,23,25).
What are the key properties of methyl 2-(2,2-dimethylpropanoylamino)-2-[2-fluoro-4-[(1-methylcyclopentyl)methoxy]phenyl]acetate?
methyl 2-(2,2-dimethylpropanoylamino)-2-[2-fluoro-4-[(1-methylcyclopentyl)methoxy]phenyl]acetate has a molecular weight of 379.47 g/mol, XLogP of 4.16, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,2-dimethylpropanoylamino)-2-[2-fluoro-4-[(1-methylcyclopentyl)methoxy]phenyl]acetate is sourced from PubChem (CID 176657255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).