C9H14Cl3F3O3 — CID 176657612
4,6,6-trichloro-7,7,7-trifluoro-3,3-dimethylheptanoic acid;hydrate (PubChem CID 176657612) has the molecular formula C9H14Cl3F3O3 and a molecular weight of 333.56 g/mol. Its IUPAC name is 4,6,6-trichloro-7,7,7-trifluoro-3,3-dimethylheptanoic acid;hydrate.
| Compound Name | 4,6,6-trichloro-7,7,7-trifluoro-3,3-dimethylheptanoic acid;hydrate |
|---|---|
| PubChem CID | 176657612 |
| Molecular Formula | C9H14Cl3F3O3 |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 4,6,6-trichloro-7,7,7-trifluoro-3,3-dimethylheptanoic acid;hydrate |
| SMILES | CC(C)(CC(=O)O)C(Cl)CC(Cl)(Cl)C(F)(F)F.O |
| InChI | InChI=1S/C9H12Cl3F3O2.H2O/c1-7(2,4-6(16)17)5(10)3-8(11,12)9(13,14)15;/h5H,3-4H2,1-2H3,(H,16,17);1H2 |
| InChIKey | AEAALUGRKIHSSE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|