C53H99O11P — CID 176659111
2,3-bis[(8-heptadecan-9-yloxy-8-oxooctanoyl)oxy]propoxy-oxido-oxophosphanium (PubChem CID 176659111) has the molecular formula C53H99O11P and a molecular weight of 943.34 g/mol. Its IUPAC name is 2,3-bis[(8-heptadecan-9-yloxy-8-oxooctanoyl)oxy]propoxy-oxido-oxophosphanium.
| Compound Name | 2,3-bis[(8-heptadecan-9-yloxy-8-oxooctanoyl)oxy]propoxy-oxido-oxophosphanium |
|---|---|
| PubChem CID | 176659111 |
| Molecular Formula | C53H99O11P |
| Molecular Weight | 943.34 g/mol |
| Exact Mass | 942.69 |
| IUPAC Name | 2,3-bis[(8-heptadecan-9-yloxy-8-oxooctanoyl)oxy]propoxy-oxido-oxophosphanium |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCC(=O)OCC(CO[P+](=O)[O-])OC(=O)CCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C53H99O11P/c1-5-9-13-17-21-29-37-47(38-30-22-18-14-10-6-2)62-51(55)42-34-26-25-33-41-50(54)60-45-49(46-61-65(58)59)64-53(57)44-36-28-27-35-43-52(56)63-48(39-31-23-19-15-11-7-3)40-32-24-20-16-12-8-4/h47-49H,5-46H2,1-4H3 |
| InChIKey | BJVQPTKYNCGUTR-UHFFFAOYSA-N |
| XLogP | 14.98 |
| TPSA | 154.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.34 |
| LogP ≤ 5 | 14.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|