C47H90NO12P — CID 176659118
9-O-[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-(8-heptadecan-9-yloxy-8-oxooctanoyl)oxypropan-2-yl] 1-O-octyl nonanedioate (PubChem CID 176659118) has the molecular formula C47H90NO12P and a molecular weight of 892.21 g/mol. Its IUPAC name is 9-O-[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-(8-heptadecan-9-yloxy-8-oxooctanoyl)oxypropan-2-yl] 1-O-octyl nonanedioate.
| Compound Name | 9-O-[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-(8-heptadecan-9-yloxy-8-oxooctanoyl)oxypropan-2-yl] 1-O-octyl nonanedioate |
|---|---|
| PubChem CID | 176659118 |
| Molecular Formula | C47H90NO12P |
| Molecular Weight | 892.21 g/mol |
| Exact Mass | 891.62 |
| IUPAC Name | 9-O-[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-(8-heptadecan-9-yloxy-8-oxooctanoyl)oxypropan-2-yl] 1-O-octyl nonanedioate |
| SMILES | CCCCCCCCOC(=O)CCCCCCCC(=O)OC(COC(=O)CCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C47H90NO12P/c1-4-7-10-13-17-24-31-42(32-25-18-14-11-8-5-2)59-46(51)35-29-22-21-27-34-45(50)56-40-43(41-58-61(53,54)57-39-37-48)60-47(52)36-28-20-16-19-26-33-44(49)55-38-30-23-15-12-9-6-3/h42-43H,4-41,48H2,1-3H3,(H,53,54) |
| InChIKey | JUXHDMXNFUJZGX-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 186.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.21 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|