C9H9F5N2 — CID 176659818
4,5-dimethylidene-1-(3,3,4,4,4-pentafluorobutyl)pyrazole (PubChem CID 176659818) has the molecular formula C9H9F5N2 and a molecular weight of 240.17 g/mol. Its IUPAC name is 4,5-dimethylidene-1-(3,3,4,4,4-pentafluorobutyl)pyrazole.
| Compound Name | 4,5-dimethylidene-1-(3,3,4,4,4-pentafluorobutyl)pyrazole |
|---|---|
| PubChem CID | 176659818 |
| Molecular Formula | C9H9F5N2 |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 4,5-dimethylidene-1-(3,3,4,4,4-pentafluorobutyl)pyrazole |
| SMILES | C=c1cnn(CCC(F)(F)C(F)(F)F)c1=C |
| InChI | InChI=1S/C9H9F5N2/c1-6-5-15-16(7(6)2)4-3-8(10,11)9(12,13)14/h5H,1-4H2 |
| InChIKey | IOXDLFANKMCSQF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|